6641-55-0 Usage
Uses
Used in Pharmaceutical Research:
[(2-Ethoxyphenyl)methylideneamino]carbamic acid is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs and treatments for a range of medical conditions.
Used in Organic Synthesis:
In the field of organic synthesis, [(2-Ethoxyphenyl)methylideneamino]carbamic acid serves as a versatile building block for the creation of complex organic molecules. Its ethoxyphenyl and carbamic acid groups can be further modified or reacted to produce a variety of chemical products.
Used in Drug Development:
[(2-Ethoxyphenyl)methylideneamino]carbamic acid is employed as a potential active pharmaceutical ingredient in the development of new medications. Its specific properties may offer therapeutic benefits for certain diseases or disorders, although further research and testing are required to fully explore its potential.
Note: Since the provided materials do not specify particular industries or reasons for the applications, the uses listed are general and based on the potential properties and common uses of similar compounds in the pharmaceutical and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6641-55-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,4 and 1 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6641-55:
(6*6)+(5*6)+(4*4)+(3*1)+(2*5)+(1*5)=100
100 % 10 = 0
So 6641-55-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2O3/c1-2-15-9-6-4-3-5-8(9)7-11-12-10(13)14/h3-7,12H,2H2,1H3,(H,13,14)/b11-7+
