6642-04-2 Usage
Uses
Used in Pharmaceutical Industry:
N,N-dibenzyl-1-(1H-pyrrol-2-yl)methanamine is utilized as a key intermediate in the synthesis of various pharmaceuticals due to its unique chemical structure and reactivity. The presence of the dibenzyl and pyrrole groups allows for the creation of new drug candidates with potential therapeutic applications.
Used in Organic Materials Synthesis:
In the field of materials science, N,N-dibenzyl-1-(1H-pyrrol-2-yl)methanamine serves as a crucial component in the development of novel organic materials. Its chemical properties contribute to the formation of materials with specific characteristics, such as improved stability or enhanced functionality, which can be applied in various technological and industrial applications.
Used in Medicinal Chemistry Research:
N,N-dibenzyl-1-(1H-pyrrol-2-yl)methanamine is employed as a research tool in medicinal chemistry to explore its potential as a precursor for the development of new drugs. Its unique structure allows researchers to investigate its interactions with biological targets and evaluate its efficacy in treating specific diseases or conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 6642-04-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,4 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6642-04:
(6*6)+(5*6)+(4*4)+(3*2)+(2*0)+(1*4)=92
92 % 10 = 2
So 6642-04-2 is a valid CAS Registry Number.
InChI:InChI=1/C19H20N2/c1-3-8-17(9-4-1)14-21(16-19-12-7-13-20-19)15-18-10-5-2-6-11-18/h1-13,20H,14-16H2
