6653-91-4 Usage
Uses
Used in Pharmaceutical Industry:
6-Hydrazinoimidazo[1,2-b]pyridazine is used as a key intermediate in the synthesis of heterocyclic compounds and drugs. Its unique structure and functional groups make it a valuable building block for the development of new pharmaceutical agents with potential therapeutic applications.
Used in Chemical Industry:
6-Hydrazinoimidazo[1,2-b]pyridazine is used as a starting material for the synthesis of various organic compounds and derivatives. Its versatile properties allow for the creation of new molecules with potential applications in different areas of chemistry.
Used in Materials Science:
6-Hydrazinoimidazo[1,2-b]pyridazine is used as a starting material for the development of new materials and functional molecules. Its unique structure and properties make it a promising candidate for the creation of innovative materials with potential applications in various fields, such as electronics, sensors, and energy storage.
Check Digit Verification of cas no
The CAS Registry Mumber 6653-91-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,5 and 3 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6653-91:
(6*6)+(5*6)+(4*5)+(3*3)+(2*9)+(1*1)=114
114 % 10 = 4
So 6653-91-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N5/c7-9-5-1-2-6-8-3-4-11(6)10-5/h1-4H,7H2,(H,9,10)
6653-91-4Relevant academic research and scientific papers
Deuterated acetylene derivatives, its pharmaceutical composition and application
-
Paragraph 0150; 0152; 0153; 0154, (2018/11/22)
The invention discloses a deuterated acetylenic derivative, a pharmaceutical composition and application thereof. The deuterated acetylenic derivative comprises one or more of the deuterated acetylenic derivative (I) with curative effective dose, pharmace
