66552-77-0 Usage
Uses
Used in Organic Electronics:
2,3,9,10-Tetramethylantracene is used as a key component in the production of high-performance organic light-emitting diodes (OLEDs). Its unique structure and properties contribute to the efficiency and performance of these devices, making it an essential material in the field of organic electronics.
Used in Biological and Medical Research:
2,3,9,10-Tetramethylantracene is used as a fluorescent probe in biological and medical research. Its ability to emit light upon exposure to certain wavelengths makes it a valuable tool for studying various biological processes and systems, such as cell signaling and molecular interactions.
Used in Chemical Synthesis:
2,3,9,10-Tetramethylantracene is used as a starting material or intermediate in the synthesis of various organic compounds. Its unique structure allows for the creation of a wide range of molecules with potential applications in various industries, such as pharmaceuticals and materials science.
Used in Environmental Monitoring:
2,3,9,10-Tetramethylantracene can be used as a tracer in environmental studies, helping to track the movement and behavior of pollutants in the environment. Its fluorescent properties make it easier to detect and monitor, providing valuable information for environmental scientists and policymakers.
Check Digit Verification of cas no
The CAS Registry Mumber 66552-77-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,5,5 and 2 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 66552-77:
(7*6)+(6*6)+(5*5)+(4*5)+(3*2)+(2*7)+(1*7)=150
150 % 10 = 0
So 66552-77-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H18/c1-11-9-17-13(3)15-7-5-6-8-16(15)14(4)18(17)10-12(11)2/h5-10H,1-4H3
