66568-83-0 Usage
General Description
(S)-6,7-Dihydro-1,2,3-trimethoxy-10-(methylthio)-7-(2-O,3-O,4-O,6-O-tetraacetyl-β-D-glucopyranosylamino)benzo[a]heptalen-9(5H)-one is a complex and highly specific chemical compound with a long and detailed name. It consists of a benzo[a]heptalen core structure with multiple functional groups attached, including methoxy, methylthio, and acetyl groups. Additionally, it contains a β-D-glucopyranosylamino group, an important component in carbohydrate chemistry. (S)-6,7-Dihydro-1,2,3-trimethoxy-10-(methylthio)-7-(2-O,3-O,4-O,6-O-tetraacetyl-β-D-glucopyranosylamino)benzo[a]heptalen-9(5H)-one likely has unique and specific properties due to its complex structure, and it may have potential applications in fields such as medicinal chemistry or organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 66568-83-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,5,6 and 8 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 66568-83:
(7*6)+(6*6)+(5*5)+(4*6)+(3*8)+(2*8)+(1*3)=170
170 % 10 = 0
So 66568-83-0 is a valid CAS Registry Number.
InChI:InChI=1/C34H41NO13S/c1-16(36)44-15-26-30(45-17(2)37)32(46-18(3)38)33(47-19(4)39)34(48-26)35-23-11-9-20-13-25(41-5)29(42-6)31(43-7)28(20)21-10-12-27(49-8)24(40)14-22(21)23/h10,12-14,23,26,30,32-35H,9,11,15H2,1-8H3/t23-,26?,30?,32?,33?,34?/m0/s1