66635-69-6 Usage
Uses
Used in Pharmaceutical Research:
2,3-dihydro-1H-pyrrolizine-1,7-dicarboxylic acid is used as a building block in pharmaceutical research for its potential to contribute to the development of new drugs. Its structure and properties allow for the creation of compounds with diverse chemical and biological activities, which can be further explored for therapeutic applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 2,3-dihydro-1H-pyrrolizine-1,7-dicarboxylic acid is utilized as a key intermediate in the synthesis of complex organic molecules. Its presence in these molecules can influence their pharmacological properties, making it a valuable component in the design and synthesis of novel drug candidates.
Used in Organic Synthesis:
2,3-dihydro-1H-pyrrolizine-1,7-dicarboxylic acid is employed as a versatile reagent in organic synthesis, where its carboxylic acid groups can participate in various chemical reactions, such as esterification, amidation, and condensation, to form a wide range of chemical compounds with potential applications in different industries.
Used in Drug Development:
2,3-dihydro-1H-pyrrolizine-1,7-dicarboxylic acid is used as a precursor in drug development, where its unique structure can be modified to create new compounds with specific biological activities. Further research and study of 2,3-dihydro-1Hpyrrolizine-1,7-dicarboxylic acid may lead to the discovery of innovative drug candidates with potential therapeutic benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 66635-69-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,6,3 and 5 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 66635-69:
(7*6)+(6*6)+(5*6)+(4*3)+(3*5)+(2*6)+(1*9)=156
156 % 10 = 6
So 66635-69-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H9NO4/c11-8(12)5-1-3-10-4-2-6(7(5)10)9(13)14/h1,3,6H,2,4H2,(H,11,12)(H,13,14)
66635-69-6Relevant academic research and scientific papers
Process for preparing (+)-2,3-dihydro-1H-pyrrolo[1,2-a]pyrrole-1,7-dicarboxylates
-
, (2008/06/13)
2,3-Dihydro-1H-pyrrolo[1,2-a]pyrrole-1,7-dicarboxylates of the formula, STR1 in which each R is independently H or lower alkyl, are prepared from di(lower alkyl) 1,3-acetone-dicarboxylates.
5-(2-Pyrroyl)-1,2-dihydro-3H-pyrrolo?1,2-a!pyrrole-1-carboxylic acid derivatives and process for the production thereof
-
, (2008/06/13)
Novel 5-(2-pyrroyl) and 5-(N-lower alkyl-2-pyrroyl)-1,2-dihydro-3H-pyrrolo?1,2-a!pyrrole-1-carboxylic acid compounds represented by the formula: STR1 and the pharmaceutically acceptable, non-toxic esters and salts thereof, wherein each of R and R1 is independently hydrogen or a lower alkyl group having from 1 to 4 carbon atoms and process for the production of such compounds; 5-(N-methyl-2-pyrroyl)-1,2-dihydro-3H-pyrrolo?1,2-a!pyrrole-1-carboxylic acid is representative of the class. These compounds are useful as anti-inflammatory analgesic and anti-pyretic agents and as smooth muscle relaxants.
