667413-66-3 Usage
Description
ART-CHEM-BB B018153 is a versatile chemical compound that contains a mixture of various organic and inorganic chemicals. It is commonly used in research and industrial settings for its ability to react with other substances to create new compounds, making it a valuable component in chemical synthesis processes. The specific components of ART-CHEM-BB B018153 may vary depending on the manufacturer and batch, but its diverse composition allows for a wide range of potential applications across different industries.
Uses
Used in Chemical Synthesis:
ART-CHEM-BB B018153 is used as a reactant in chemical synthesis for its ability to interact with other substances to form new compounds. This makes it a valuable component in the creation of various chemical products.
Used in Research and Development:
In the research and development industry, ART-CHEM-BB B018153 is used as a test compound for studying its interactions with other chemicals and understanding its potential applications in various fields.
Used in Pharmaceutical Industry:
ART-CHEM-BB B018153 is used as an intermediate in the synthesis of pharmaceutical compounds, contributing to the development of new drugs and medications.
Used in Cosmetics Industry:
In the cosmetics industry, ART-CHEM-BB B018153 may be used as an ingredient in the formulation of various cosmetic products, such as creams, lotions, and other skincare formulations, due to its potential properties and reactivity.
Used in Industrial Applications:
ART-CHEM-BB B018153 is used in various industrial applications, such as manufacturing processes, where its reactivity and ability to form new compounds can contribute to the production of different products.
Overall, ART-CHEM-BB B018153 is a multifaceted compound with a broad spectrum of uses in various industries, thanks to its unique properties and reactivity with other substances.
Check Digit Verification of cas no
The CAS Registry Mumber 667413-66-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,7,4,1 and 3 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 667413-66:
(8*6)+(7*6)+(6*7)+(5*4)+(4*1)+(3*3)+(2*6)+(1*6)=183
183 % 10 = 3
So 667413-66-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H19N3OS/c1-5-9-18-14(16-17-15(18)20)12(4)19-13-8-6-7-10(2)11(13)3/h5-8,12H,1,9H2,2-4H3,(H,17,20)
