667436-67-1 Usage
Benzaldehyde derivative
A derivative of benzaldehyde This means that the compound is structurally related to benzaldehyde (C7H6O) with modifications in its structure, such as the presence of a chlorine atom and a bromobenzyl group.
Chlorine atom at the 5th position
The chlorine atom is attached to the benzene ring at the 5th position This refers to the position of the chlorine atom on the benzene ring, which influences the compound's reactivity and properties.
Bromobenzyl group attached to an oxygen atom at the 2nd position
The bromine-containing group is connected to an oxygen atom, which is attached to the benzene ring at the 2nd position This describes the specific attachment of the bromobenzyl group to the compound, affecting its reactivity and properties.
Organic synthesis and pharmaceutical research
Used as a building block for the synthesis of more complex molecules This highlights the compound's role in creating more complex chemical structures, which can be used in the development of new pharmaceuticals and other organic compounds.
Reagent in chemical reactions
Employed in various chemical reactions, including the formation of carbon-carbon and carbon-heteroatom bonds This indicates the compound's versatility in facilitating different types of chemical reactions, which can lead to the creation of new molecules.
Unique reactivity
Exhibits unique reactivity due to its structural features This refers to the compound's specific chemical behavior, which can be exploited in the development of novel pharmaceuticals and agrochemicals.
Development of novel pharmaceuticals and agrochemicals
Can be employed in the creation of new drugs and agricultural chemicals This demonstrates the practical applications of the compound in the development of new products for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 667436-67-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,7,4,3 and 6 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 667436-67:
(8*6)+(7*6)+(6*7)+(5*4)+(4*3)+(3*6)+(2*6)+(1*7)=201
201 % 10 = 1
So 667436-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H10BrClO2/c15-12-3-1-10(2-4-12)9-18-14-6-5-13(16)7-11(14)8-17/h1-8H,9H2