667462-09-1 Usage
Chemical composition
2-(1-Piperazinyl)acetic acid monohydrate is an organic compound that contains a piperazine ring and a water molecule.
Use in pharmaceutical research and development
This compound is commonly used as an intermediate in the synthesis of various pharmaceuticals, particularly those targeting neurotransmitter receptors.
Potential pharmacological properties
Researchers are interested in 2-(1-Piperazinyl)acetic acid monohydrate for its potential therapeutic applications and pharmacological properties.
Value in chemical research
The unique structure and properties of this compound make it a valuable chemical for further study and potential drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 667462-09-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,7,4,6 and 2 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 667462-09:
(8*6)+(7*6)+(6*7)+(5*4)+(4*6)+(3*2)+(2*0)+(1*9)=191
191 % 10 = 1
So 667462-09-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2O2/c9-6(10)5-8-3-1-7-2-4-8/h7H,1-5H2,(H,9,10)/p+1
