66799-93-7 Usage
Uses
Used in Organic Synthesis:
7-bromobenzo[d][1,3]dioxole-5-carboxylic acid is used as a building block for the synthesis of various pharmaceuticals, agrochemicals, and other biologically active molecules. Its chemical structure and properties make it a valuable intermediate for the production of complex organic compounds.
Used in Medicinal Chemistry:
7-bromobenzo[d][1,3]dioxole-5-carboxylic acid is used as a building block for the synthesis of various pharmaceuticals and biologically active molecules. Its chemical structure and properties make it a valuable intermediate for the production of complex organic compounds.
Used in Research:
7-bromobenzo[d][1,3]dioxole-5-carboxylic acid is a useful tool for researchers studying the structure-activity relationships of different chemical entities. Its unique chemical structure allows for the investigation of various chemical reactions and interactions, contributing to the advancement of chemical knowledge and understanding.
Check Digit Verification of cas no
The CAS Registry Mumber 66799-93-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,7,9 and 9 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 66799-93:
(7*6)+(6*6)+(5*7)+(4*9)+(3*9)+(2*9)+(1*3)=197
197 % 10 = 7
So 66799-93-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H5BrO4/c9-5-1-4(8(10)11)2-6-7(5)13-3-12-6/h1-2H,3H2,(H,10,11)