66813-29-4 Usage
General Description
8-(Hydroxyethylamino)-adenine is a chemical compound that belongs to the class of adenine derivatives. It is a modified form of adenine with a hydroxyethylamine group attached to the eighth carbon atom of the adenine ring. This modification can have various biological and pharmacological effects, as it can alter the interactions of adenine with other molecules and biological systems. 8-(Hydroxyethylamino)-adenine has been studied for its potential applications in medicine, including as a potential therapeutic agent for various diseases and as a component in drug delivery systems. Its unique structure and properties make it an interesting molecule for further research into its potential uses in biotechnology and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 66813-29-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,8,1 and 3 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 66813-29:
(7*6)+(6*6)+(5*8)+(4*1)+(3*3)+(2*2)+(1*9)=144
144 % 10 = 4
So 66813-29-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N6O/c8-5-4-6(11-3-10-5)13-7(12-4)9-1-2-14/h3,14H,1-2H2,(H4,8,9,10,11,12,13)
