668471-48-5 Usage
Uses
Used in Pharmaceutical Industry:
4-(2,4-DICHLOROPHENYL)-5-(1-METHYL-1H-PYRROL-2-YL)-4H-1,2,4-TRIAZOLE-3-THIOL is used as an anti-inflammatory agent for its potential to alleviate inflammation and associated symptoms. Its unique structure allows it to modulate biological pathways involved in inflammatory responses.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(2,4-DICHLOROPHENYL)-5-(1-METHYL-1H-PYRROL-2-YL)-4H-1,2,4-TRIAZOLE-3-THIOL is used as a fungicide to protect crops from fungal infections, thereby enhancing crop yield and quality.
Used in Research and Development:
4-(2,4-DICHLOROPHENYL)-5-(1-METHYL-1H-PYRROL-2-YL)-4H-1,2,4-TRIAZOLE-3-THIOL serves as a building block in the synthesis of various biologically active compounds. Its unique structural features make it a valuable component for creating new molecules with potential applications in medicine and agriculture.
Overall, 4-(2,4-DICHLOROPHENYL)-5-(1-METHYL-1H-PYRROL-2-YL)-4H-1,2,4-TRIAZOLE-3-THIOL is a versatile chemical with promising applications across different fields, warranting further exploration and development.
Check Digit Verification of cas no
The CAS Registry Mumber 668471-48-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,8,4,7 and 1 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 668471-48:
(8*6)+(7*6)+(6*8)+(5*4)+(4*7)+(3*1)+(2*4)+(1*8)=205
205 % 10 = 5
So 668471-48-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H10Cl2N4S/c1-18-6-2-3-11(18)12-16-17-13(20)19(12)10-5-4-8(14)7-9(10)15/h2-7H,1H3,(H,17,20)
