6687-82-7 Usage
Uses
Used in Organic Synthesis:
[(3,4-Dihydroisoquinolin-2(1H)-yl)methylene]malononitrile is used as a building block in organic synthesis for the preparation of various heterocyclic and biologically active compounds. Its unique structure and reactivity contribute to the development of new chemical processes and materials.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, [(3,4-Dihydroisoquinolin-2(1H)-yl)methylene]malononitrile is utilized for the synthesis of potential drug candidates. Its properties make it a compound of interest for researchers working in drug discovery and material science.
Used in Drug Discovery:
Due to its potential applications in drug discovery, [(3,4-Dihydroisoquinolin-2(1H)-yl)methylene]malononitrile is a compound that attracts attention from researchers in various fields of chemistry. Its unique structure and reactivity can be harnessed to develop new drug candidates with potential therapeutic applications.
Used in Material Science:
[(3,4-Dihydroisoquinolin-2(1H)-yl)methylene]malononitrile also holds promise in the field of material science. Its unique properties can be exploited to create new materials with specific characteristics, potentially leading to advancements in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6687-82-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,8 and 7 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6687-82:
(6*6)+(5*6)+(4*8)+(3*7)+(2*8)+(1*2)=137
137 % 10 = 7
So 6687-82-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H11N3/c14-7-11(8-15)9-16-6-5-12-3-1-2-4-13(12)10-16/h1-4,9H,5-6,10H2