66941-94-4 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Benzyl-5-butyl-2,4,6(1H,3H,5H)-pyrimidinetrione is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows for the creation of new drug molecules with potential therapeutic applications.
Used in Medicinal Chemistry and Drug Discovery:
In the field of medicinal chemistry, 5-Benzyl-5-butyl-2,4,6(1H,3H,5H)-pyrimidinetrione serves as a valuable compound for the study and development of biologically active substances. Its unique properties enable researchers to explore its potential in the creation of new drugs and therapeutic agents.
Used in Organic Compound Synthesis:
5-Benzyl-5-butyl-2,4,6(1H,3H,5H)-pyrimidinetrione is also utilized in the synthesis of other organic compounds, contributing to the development of new chemical entities with diverse applications across various industries.
Used in Research and Development:
5-Benzyl-5-butyl-2,4,6(1H,3H,5H)-pyrimidinetrione's structure and properties make it a useful tool in research and development, particularly in the study of pyrimidine derivatives and their potential applications in various fields, including pharmaceuticals, materials science, and chemical biology.
Check Digit Verification of cas no
The CAS Registry Mumber 66941-94-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,9,4 and 1 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 66941-94:
(7*6)+(6*6)+(5*9)+(4*4)+(3*1)+(2*9)+(1*4)=164
164 % 10 = 4
So 66941-94-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2O3/c1-2-3-9-15(10-11-7-5-4-6-8-11)12(18)16-14(20)17-13(15)19/h4-8H,2-3,9-10H2,1H3,(H2,16,17,18,19,20)
