669713-67-1 Usage
Uses
Used in Pharmaceutical Industry:
(S)-N-[4'-BENZYL)PIPERIDINO]PROLINE is used as a potential therapeutic agent for neurological conditions due to its ability to interact with neurotransmitter receptors and modulate their activity. Its impact on the central nervous system makes it a promising candidate for the development of drugs to treat various neurological disorders.
Used in Neuropharmacology Research:
(S)-N-[4'-BENZYL)PIPERIDINO]PROLINE is used as a research compound to study its potential as a drug candidate for the treatment of neurological conditions. Its interaction with neurotransmitter receptors and modulation of their activity can provide valuable insights into the development of new therapeutic approaches for various neurological disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 669713-67-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,9,7,1 and 3 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 669713-67:
(8*6)+(7*6)+(6*9)+(5*7)+(4*1)+(3*3)+(2*6)+(1*7)=211
211 % 10 = 1
So 669713-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H24N2O2/c20-17(21)16-7-4-10-19(16)15-8-11-18(12-9-15)13-14-5-2-1-3-6-14/h1-3,5-6,15-16H,4,7-13H2,(H,20,21)/t16-/m0/s1
