669713-91-1 Usage
Uses
Used in Pharmaceutical Industry:
(1-BIPHENYL-4-YL-2-PYRROLIDIN-1-YL-ETHYL)-METHYL-AMINE is used as a psychotropic and psychoactive agent for its potential applications in the development of medications targeting neurological and psychiatric disorders. Its unique structure and properties allow it to interact with neurotransmitter receptors, offering new avenues for therapeutic intervention.
Used in Research and Development:
In the field of neurochemistry, (1-BIPHENYL-4-YL-2-PYRROLIDIN-1-YL-ETHYL)-METHYL-AMINE is utilized as a research tool to study the interactions between neurotransmitter receptors and various psychoactive substances. This helps in understanding the mechanisms of action and potential therapeutic effects of such compounds.
Used as a Precursor in Chemical Synthesis:
(1-BIPHENYL-4-YL-2-PYRROLIDIN-1-YL-ETHYL)-METHYL-AMINE serves as a precursor in the synthesis of other related chemical compounds, expanding its utility in various chemical and pharmaceutical processes. Its unique structure allows for the creation of novel compounds with potential applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 669713-91-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,6,9,7,1 and 3 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 669713-91:
(8*6)+(7*6)+(6*9)+(5*7)+(4*1)+(3*3)+(2*9)+(1*1)=211
211 % 10 = 1
So 669713-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C19H24N2/c1-20-19(15-21-13-5-6-14-21)18-11-9-17(10-12-18)16-7-3-2-4-8-16/h2-4,7-12,19-20H,5-6,13-15H2,1H3
