670253-59-5 Usage
Uses
Used in Pharmaceutical Development:
3-AMINO-1-PYRROLIDIN-1-YL-PROPAN-1-ONE HCL is used as a chemical precursor for the development of pharmaceuticals, leveraging its unique structure to create new compounds with therapeutic potential.
Used in Research and Experimentation:
In the scientific community, 3-AMINO-1-PYRROLIDIN-1-YL-PROPAN-1-ONE HCL is employed as a research compound to study its psychoactive effects and explore its potential applications in various fields of study.
Used in Chemical Reactions:
3-AMINO-1-PYRROLIDIN-1-YL-PROPAN-1-ONE HCL is utilized as a reactant in chemical processes, where its specific properties contribute to the synthesis of other compounds or materials.
Check Digit Verification of cas no
The CAS Registry Mumber 670253-59-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,0,2,5 and 3 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 670253-59:
(8*6)+(7*7)+(6*0)+(5*2)+(4*5)+(3*3)+(2*5)+(1*9)=155
155 % 10 = 5
So 670253-59-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H14N2O.ClH/c8-4-3-7(10)9-5-1-2-6-9;/h1-6,8H2;1H
670253-59-5Relevant academic research and scientific papers
AZAARENE DERIVATIVES
-
Page/Page column 57, (2008/06/13)
A compound represented by the general formula: wherein X1 represents a nitrogen atom or a group represented by the formula -CR10=; X2 represents a nitrogen atom or a group represented by the formula -CR11=; Y represents an oxygen atom or the like; R1 represents a C1-6 alkoxy group, an optionally substituted C6-10 aryloxy group, a group represented by the formula -NR12aR12b or the like; R2 represents a hydrogen atom, an optionally substituted C1-6 alkyl group, or the like; R3, R4, R5, R6, R7, R8, R10 and R11 each independently represent a hydrogen atom, a halogen atom, an optionally substituted C1-6 alkyl group, or the like; R9 represents a group represented by the formula -NR16aR16b or the like; and R12a, R12b, R16a and R16b each independently represent a hydrogen atom, an optionally substituted C1-6 alkyl group, or the like, a salt thereof, or a hydrate of the foregoing.
