67059-49-8 Usage
Uses
1,1-Diethoxy-1-silacyclopent-3-ene is used as a chemical intermediate in the synthesis of various organosilicon compounds. Its unique structure and functional groups make it a valuable building block for the development of new materials and products in the chemical industry.
Used in Chemical Research:
1,1-Diethoxy-1-silacyclopent-3-ene is used as a research compound for studying the properties and reactivity of organosilicon compounds. Its complex structure provides opportunities for investigating the influence of silicon on the chemical behavior of molecules.
Used in Material Science:
1,1-Diethoxy-1-silacyclopent-3-ene is used as a precursor in the development of new materials with potential applications in various industries, such as electronics, pharmaceuticals, and coatings. Its unique properties may contribute to the creation of innovative products with enhanced performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 67059-49-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,0,5 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 67059-49:
(7*6)+(6*7)+(5*0)+(4*5)+(3*9)+(2*4)+(1*9)=148
148 % 10 = 8
So 67059-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H16O2Si/c1-3-9-11(10-4-2)7-5-6-8-11/h5-6H,3-4,7-8H2,1-2H3
