67067-94-1 Usage
Uses
Used in Pharmaceutical Research:
Ethyl Morpholinoacetate Hydrochloride is used as a reagent for facilitating various chemical reactions in the development of new pharmaceutical compounds. Its unique structural components allow it to participate in a range of reactions, making it a valuable tool in drug discovery and synthesis.
Used in Organic Synthesis:
In the field of organic chemistry, Ethyl Morpholinoacetate Hydrochloride is employed as an intermediate in the synthesis of more complex organic molecules. Its presence can influence the outcome of reactions, enabling the creation of a diverse array of chemical products.
Used in Chemical Reactions:
Ethyl Morpholinoacetate Hydrochloride is used as a reagent in a variety of chemical reactions, contributing to the formation of new compounds or the modification of existing ones. Its versatility in participating in different types of reactions makes it a useful component in the chemical industry.
Used in Scientific Research:
Ethyl Morpholinoacetate Hydrochloride is utilized in scientific research to study the properties and behavior of various chemical systems. Its involvement in experiments can provide insights into reaction mechanisms, the formation of new compounds, and the potential applications of these compounds in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 67067-94-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,0,6 and 7 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 67067-94:
(7*6)+(6*7)+(5*0)+(4*6)+(3*7)+(2*9)+(1*4)=151
151 % 10 = 1
So 67067-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H13NO3.ClH/c1-6-4-8(2-3-11-6)5-7(9)10;/h6H,2-5H2,1H3,(H,9,10);1H/p-1
