671-42-1 Usage
Uses
Used in Pharmaceutical Industry:
DL-ALPHA-AMINO-EPSILON-CAPROLACTAM is used as an active pharmaceutical ingredient for the development of various drugs. Its unique structure and properties allow it to be incorporated into drug formulations, enhancing their efficacy and stability.
Used in Cosmetics Industry:
In the cosmetics industry, DL-ALPHA-AMINO-EPSILON-CAPROLACTAM is used as a key ingredient in various skincare and hair care products. Its ability to form complexes with metal ions and its chelating properties make it an effective ingredient for improving the texture, stability, and performance of cosmetic formulations.
Used in Food Industry:
DL-ALPHA-AMINO-EPSILON-CAPROLACTAM is used in the food industry as a flavor enhancer and a taste modifier. Its unique taste profile and ability to interact with other food components contribute to the overall flavor and texture of various food products.
Used in Chemical Synthesis:
DL-ALPHA-AMINO-EPSILON-CAPROLACTAM is used as a building block in the synthesis of various chemical compounds, including polymers, pharmaceuticals, and other specialty chemicals. Its cyclic structure and reactive functional groups make it a versatile starting material for the development of new and innovative products.
Used in Research and Development:
DL-ALPHA-AMINO-EPSILON-CAPROLACTAM is utilized in research and development settings as a model compound for studying various chemical and biological processes. Its unique structure and properties provide valuable insights into the mechanisms of various reactions and interactions, contributing to the advancement of scientific knowledge and the development of new technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 671-42-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,7 and 1 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 671-42:
(5*6)+(4*7)+(3*1)+(2*4)+(1*2)=71
71 % 10 = 1
So 671-42-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2O/c7-5-3-1-2-4-8-6(5)9/h5H,1-4,7H2,(H,8,9)
