67114-23-2 Usage
Main Properties
1. Chemical Name: 4-[2-[N-Ethyl-N-[4-(3,4,5-trimethoxybenzoyloxy)butyl]amino]ethyl]benzoic acid ethyl ester
2. Molecular Formula: C31H43NO7
3. Type: Organic compound
4. Functional Groups: Ethyl ester, aminoethyl, trimethoxybenzoyloxy, N-ethyl
5. Complexity: Highly complex
6. Potential Applications: Pharmaceuticals, organic synthesis, biochemistry
Benzoic Acid Derivative
Contains a benzoic acid moiety as its core structure.
Ethyl Ester Group
Features an ethyl ester group, indicating it's an ester derivative.
Aminoethyl Substituent
Contains a long chain aminoethyl substituent.
Trimethoxybenzoyloxy Substituent
Incorporates a trimethoxybenzoyloxy substituent.
N-Ethyl Substituent
Contains an N-ethyl substituent.
Functional Complexity
Exhibits multiple functional groups, contributing to its complexity.
Potential Applications
Offers potential utility in pharmaceuticals, organic synthesis, and various areas of chemistry and biochemistry due to its unique structure and functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 67114-23-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,1,1 and 4 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 67114-23:
(7*6)+(6*7)+(5*1)+(4*1)+(3*4)+(2*2)+(1*3)=112
112 % 10 = 2
So 67114-23-2 is a valid CAS Registry Number.
InChI:InChI=1/C27H37NO7/c1-6-28(16-14-20-10-12-21(13-11-20)26(29)34-7-2)15-8-9-17-35-27(30)22-18-23(31-3)25(33-5)24(19-22)32-4/h10-13,18-19H,6-9,14-17H2,1-5H3