671189-54-1 Usage
Uses
Used in Organic Synthesis:
2,3-BIS(N-BUTYLTHIO)-1,4-NAPHTHALENEDIONE is used as a reagent in organic synthesis for the production of various organic compounds. Its unique chemical structure allows it to participate in a range of reactions, contributing to the synthesis of complex molecules.
Used in Polymerization Processes:
In the polymer industry, 2,3-BIS(N-BUTYLTHIO)-1,4-NAPHTHALENEDIONE is employed as a photoinitiator, playing a crucial role in the polymerization process. It helps initiate the reaction by absorbing light energy, which triggers the polymerization of monomers into polymers.
Used in Dye and Pigment Manufacturing:
2,3-BIS(N-BUTYLTHIO)-1,4-NAPHTHALENEDIONE is an important raw material in the manufacture of dyes and pigments. Its chemical properties make it suitable for creating a wide range of colorants used in various applications, including textiles, plastics, and printing inks.
Used in Chemical Research:
Due to its unique structure and reactivity, 2,3-BIS(N-BUTYLTHIO)-1,4-NAPHTHALENEDIONE is also utilized in chemical research for studying reaction mechanisms, exploring new synthetic routes, and developing novel applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 671189-54-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,1,1,8 and 9 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 671189-54:
(8*6)+(7*7)+(6*1)+(5*1)+(4*8)+(3*9)+(2*5)+(1*4)=181
181 % 10 = 1
So 671189-54-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H22O2S2/c1-3-5-11-21-17-15(19)13-9-7-8-10-14(13)16(20)18(17)22-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3
