671192-09-9 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 14 carbon (C), 9 hydrogen (H), 1 chlorine (Cl), 1 fluorine (F), 1 nitrogen (N), and 2 oxygen (O) atoms.
Explanation
This describes the arrangement of atoms and the type of chemical bonds between them. The compound has a furan ring, a phenyl ring, and an ethanone group.
Explanation
A ketone derivative is a compound that contains a carbonyl group (C=O) bonded to two carbon atoms. In this case, the carbonyl group is part of the ethanone group.
Explanation
The compound has two types of aromatic rings a furan ring, which is a five-membered ring with one oxygen atom, and a phenyl ring, which is a six-membered ring with alternating double bonds.
Explanation
The phenyl ring has two substituents a chlorine atom at the 3rd position and a fluorine atom at the 4th position. These substitutions can affect the compound's reactivity, stability, and biological activity.
Explanation
The compound is used in the pharmaceutical industry for the synthesis of various drugs. Its unique structure and functional groups make it a valuable building block for developing new therapeutic agents.
Explanation
Due to its structural features, 1-[5-(3-chloro-4-fluorophenyl)-2-furyl]ethan-1-one can be used to create new drugs with potential therapeutic applications, such as treating various diseases or conditions.
Explanation
The presence of the ethyl functional group in the molecule makes it a versatile building block for the synthesis of different organic compounds, allowing for the creation of a wide range of chemical structures with various properties and applications.
Explanation
As a valuable chemical in the pharmaceutical industry, 1-[5-(3-chloro-4-fluorophenyl)-2-furyl]ethan-1-one plays a crucial role in drug discovery and development, contributing to the advancement of new treatments and therapies.
Chemical Structure
1-[5-(3-chloro-4-fluorophenyl)-2-furyl]ethan-1-one
Type of Compound
Ketone derivative
Presence of Rings
Furan ring and Phenyl ring
Substitutions
3-chloro and 4-fluoro on the phenyl ring
Application
Pharmaceutical industry
Potential Therapeutic Applications
Development of new pharmaceuticals
Versatility
Ethyl functional group
Importance
Drug discovery and development
Check Digit Verification of cas no
The CAS Registry Mumber 671192-09-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,1,1,9 and 2 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 671192-09:
(8*6)+(7*7)+(6*1)+(5*1)+(4*9)+(3*2)+(2*0)+(1*9)=159
159 % 10 = 9
So 671192-09-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H8ClFO2/c1-7(15)11-4-5-12(16-11)8-2-3-10(14)9(13)6-8/h2-6H,1H3
