67191-93-9 Usage
Uses
Used in Pharmaceutical Industry:
5-Fluoro-2-methylphenyl isocyanate is used as a key intermediate for the synthesis of various pharmaceutical compounds. Its isocyanate group allows for the formation of carbamates and ureas, which are common structural elements in many drugs. The presence of the fluorine atom and the methyl group on the aromatic ring provide opportunities for further functionalization and diversification of the resulting molecules, making it a versatile building block in drug development.
Used in Agrochemical Industry:
In the agrochemical industry, 5-Fluoro-2-methylphenyl isocyanate is used as a starting material for the creation of new pesticides and herbicides. The isocyanate group can be reacted with various amines, alcohols, and other nucleophiles to produce a wide range of active ingredients with different modes of action, contributing to the development of more effective and targeted agrochemicals.
Used in Polymer Industry:
5-Fluoro-2-methylphenyl isocyanate is employed as a monomer in the polymer industry for the production of polyurethanes and other isocyanate-based polymers. The fluorine atom in the molecule can enhance the polymer's properties, such as its thermal stability, chemical resistance, and mechanical strength. Additionally, the presence of the isocyanate group allows for the creation of polymers with a diverse range of structures and functionalities.
Used in Dye and Pigment Industry:
5-Fluoro-2-methylphenyl isocyanate is used as a building block for the synthesis of various dyes and pigments. The presence of the fluorine atom and the aromatic ring in the molecule can contribute to the color properties and stability of the resulting dyes and pigments. This makes it a valuable component in the development of new colorants for various applications, such as textiles, plastics, and printing inks.
Used in Coatings Industry:
In the coatings industry, 5-Fluoro-2-methylphenyl isocyanate is used as a component in the formulation of various types of coatings, such as automotive coatings, industrial coatings, and protective coatings. The isocyanate group can react with other components in the formulation to form cross-linked networks, which can improve the durability, chemical resistance, and adhesion properties of the coatings. Additionally, the fluorine atom can enhance the water and oil repellency of the coatings, making them more suitable for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 67191-93-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,1,9 and 1 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 67191-93:
(7*6)+(6*7)+(5*1)+(4*9)+(3*1)+(2*9)+(1*3)=149
149 % 10 = 9
So 67191-93-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H6FNO/c1-6-2-3-7(9)4-8(6)10-5-11/h2-4H,1H3
