672310-10-0 Usage
General Description
2-CYANO-1-N-FMOC-PIPERIDINE is a chemical compound that belongs to the piperidine class and is characterized by the presence of a cyano group and an N-FMOC protecting group. It is commonly used as a building block in organic synthesis and medicinal chemistry, particularly in the production of various pharmaceuticals and agrochemicals. 2-CYANO-1-N-FMOC-PIPERIDINE is known for its reactivity and versatility in chemical reactions, making it a valuable component in the creation of diverse molecular structures. Its unique properties and potential applications in drug discovery and material science make it a valuable tool for researchers and chemists in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 672310-10-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,2,3,1 and 0 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 672310-10:
(8*6)+(7*7)+(6*2)+(5*3)+(4*1)+(3*0)+(2*1)+(1*0)=130
130 % 10 = 0
So 672310-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C21H20N2O2/c22-13-15-7-5-6-12-23(15)21(24)25-14-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-4,8-11,15,20H,5-7,12,14H2