67399-73-9 Usage
Uses
Used in Pharmaceutical Industry:
Ethanone, 1-(2-thiazolidinyl)(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to form diverse chemical structures. Its presence in drug molecules contributes to their biological activity, making it an essential component in the development of new therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, Ethanone, 1-(2-thiazolidinyl)(9CI) serves as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds enhances their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Antibacterial and Antifungal Applications:
Ethanone, 1-(2-thiazolidinyl)(9CI) is used as an active ingredient in antibacterial and antifungal agents due to its inherent antimicrobial properties. It can be incorporated into formulations to combat a wide range of microbial infections, providing a valuable tool in the fight against drug-resistant pathogens.
Used in Materials Science:
In the field of materials science, Ethanone, 1-(2-thiazolidinyl)(9CI) has potential applications in the development of coatings and adhesives. Its unique chemical structure allows for the creation of materials with specific properties, such as improved adhesion, durability, and resistance to environmental factors.
Used in Metal Coordination Chemistry:
Ethanone, 1-(2-thiazolidinyl)(9CI) acts as a potential ligand in metal coordination chemistry, enabling the formation of coordination complexes with various metal ions. These complexes can be used in a range of applications, including catalysis and metal ion sensing, due to their unique electronic and structural properties.
Used in Catalysis:
As a component in catalytic systems, Ethanone, 1-(2-thiazolidinyl)(9CI) can enhance the efficiency and selectivity of chemical reactions. Its presence in catalysts can facilitate specific transformations, making it a valuable asset in the development of green and sustainable chemical processes.
Used in Metal Ion Sensing:
Ethanone, 1-(2-thiazolidinyl)(9CI) has potential applications in the detection and sensing of metal ions. Its ability to form complexes with metal ions can be exploited to develop sensors with high sensitivity and selectivity, which can be used in environmental monitoring, industrial processes, and medical diagnostics.
Check Digit Verification of cas no
The CAS Registry Mumber 67399-73-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,3,9 and 9 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 67399-73:
(7*6)+(6*7)+(5*3)+(4*9)+(3*9)+(2*7)+(1*3)=179
179 % 10 = 9
So 67399-73-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H9NOS/c1-4(7)5-6-2-3-8-5/h5-6H,2-3H2,1H3
67399-73-9Relevant academic research and scientific papers
Regioselectivity of the hydrolysis of 2-(1-alkoxyvinyl)-substituted imidazolidines, 1,3-thiazolidines, and 1,3-oxazolidines
Keiko,Funtikova,Vchislo,Larina,Frolov
experimental part, p. 1832 - 1840 (2012/03/27)
2-(1-Alkoxyvinyl)-1,3-thiazolidines reacted with H2O or D 2O in the presence of 105 mol % of p-toluenesulfonic acid or trifluoroacetic acid (20°C, 1 h) to give 2-acetyl-1,3-thiazolidine in quantitative yield. 2-(1-Alkoxyvinyl)-3,5-diphenylimidazolidines underwent hydrolysis in the presence of 20 mol % of an acid (20°C, 24 h) at the vinyloxy group with high regioselectivity yielding 2-acetylimidazolidines. Hydrolysis of 2-(1-alkoxyvinyl)-3-phenyl-1,3-oxazolidines in the presence of 10 mol % of p-toluenesulfonic acid (20°C, 5 days) takes two pathways, one of which involves the endocyclic C-O bond with ring opening and the other involves the vinyloxy group to produce 2-acetyl-3-phenyl-1,3-oxazolidine. Unlike phenyl-substituted 1,3-thiazolidines and imidazolidines, hydrolysis of their 3-methyl- and 3,5-dimethyl-substituted analogs in acid medium occurs mainly via ring opening. The observed hydrolysis pathways were interpreted in terms of B3PW91/6-311G(d,p) quantum-chemical calculations.