67434-30-4 Usage
Uses
Used in Organic Synthesis:
1-Pyrrolidino-2-isocyano-acetamide is utilized as a reagent for the preparation of various pyrrolidines and piperidines, which are important structural motifs in organic chemistry and have applications in the development of pharmaceuticals and agrochemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 1-Pyrrolidino-2-isocyano-acetamide serves as a key intermediate for the synthesis of potential drugs. Its unique structure allows for the creation of new drug candidates with specific therapeutic properties.
Used in Coordination Chemistry:
1-PYRROLIDINO-2-ISOCYANO-ACETAMIDE can also function as a ligand in coordination chemistry, playing a crucial role in the formation of metal complexes. These complexes have potential applications in catalysis, materials science, and as functional materials for various uses.
Used in Advanced Materials Preparation:
1-Pyrrolidino-2-isocyano-acetamide is employed as a starting material for the preparation of advanced materials, which can be utilized in a range of high-tech applications, such as sensors, energy storage, and electronic devices.
Overall, 1-pyrrolidino-2-isocyano-acetamide is a multifaceted chemical with a broad spectrum of applications in organic synthesis, pharmaceuticals, and materials chemistry, making it a valuable asset in the development of new technologies and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 67434-30-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,4,3 and 4 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 67434-30:
(7*6)+(6*7)+(5*4)+(4*3)+(3*4)+(2*3)+(1*0)=134
134 % 10 = 4
So 67434-30-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O/c1-8-6-7(10)9-4-2-3-5-9/h2-6H2
