6745-32-0 Usage
General Description
"(2S,4S)-4-Fluoropyrrolidine-2-carboxylic acid" is a specific chemical compound with the molecular formula C5H8FNO2. As an organofluorine compound, it contains fluorine, which forms a single bond with carbon and a hydrogen bond with nitrogen in the pyrrolidine ring. As indicated by its name, this chemical compound possesses both acidic (carboxylic acid) and basic (pyrrolidine) functionalities. The (2S,4S) stereodescriptor denotes the spatial arrangement of these groups in the molecule. (2S,4S)-4-Fluoropyrrolidine-2-carboxylic acid can involve in multiple chemical reactions and it could be used in chemical synthesis or as a pharmaceutical intermediate. Further studies might be needed to uncover potential applications of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 6745-32-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,7,4 and 5 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6745-32:
(6*6)+(5*7)+(4*4)+(3*5)+(2*3)+(1*2)=110
110 % 10 = 0
So 6745-32-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H8FNO2/c6-3-1-4(5(8)9)7-2-3/h3-4,7H,1-2H2,(H,8,9)/t3-,4-/m0/s1
