6745-32-0 Usage
Uses
Used in Chemical Synthesis:
(2S,4S)-4-Fluoropyrrolidine-2-carboxylic acid is used as a building block in chemical synthesis for its ability to participate in multiple chemical reactions, contributing to the creation of more complex molecules.
Used in Pharmaceutical Industry:
(2S,4S)-4-Fluoropyrrolidine-2-carboxylic acid is used as a pharmaceutical intermediate due to its potential to be incorporated into the structure of new drug molecules, leveraging its acidic and basic functionalities for medicinal chemistry applications.
Further studies might be needed to uncover additional potential applications of (2S,4S)-4-Fluoropyrrolidine-2-carboxylic acid in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6745-32-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,7,4 and 5 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6745-32:
(6*6)+(5*7)+(4*4)+(3*5)+(2*3)+(1*2)=110
110 % 10 = 0
So 6745-32-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H8FNO2/c6-3-1-4(5(8)9)7-2-3/h3-4,7H,1-2H2,(H,8,9)/t3-,4-/m0/s1
