67465-70-7 Usage
Molecular structure
10-(3-Dimethylamino-2-methylpropyl)-10H-pyrido[3,2-b][1,4]benzothiazine has a complex molecular structure with a pyrido-benzothiazine ring system and a 10-(3-dimethylamino-2-methylpropyl) substituent.
Classification
It is a heterocyclic compound due to the presence of nitrogen and sulfur atoms in its ring structure.
Potential applications
It may have potential pharmaceutical or biological applications, such as in the development of medications or as research tools in the field of pharmacology.
Research status
Further research is needed to fully understand its properties and potential uses.
Molecular weight
The molecular weight of the compound is approximately 324.49 g/mol.
Functional groups
The compound contains various functional groups, including an amine group (-NH-), a methyl group (-CH3), and a thiazine ring.
Solubility
The solubility of the compound in different solvents is not explicitly mentioned, but it may be influenced by its polar and nonpolar components.
Stability
The stability of the compound under various conditions, such as temperature, pH, and exposure to light, is not provided in the material.
Synthesis
The synthesis method for 10-(3-Dimethylamino-2-methylpropyl)-10H-pyrido[3,2-b][1,4]benzothiazine is not described in the material provided.
Check Digit Verification of cas no
The CAS Registry Mumber 67465-70-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,4,6 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 67465-70:
(7*6)+(6*7)+(5*4)+(4*6)+(3*5)+(2*7)+(1*0)=157
157 % 10 = 7
So 67465-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H21N3S/c1-13(11-19(2)3)12-20-14-7-4-5-8-15(14)21-16-9-6-10-18-17(16)20/h4-10,13H,11-12H2,1-3H3
