67465-91-2 Usage
General Description
1-(4-Indanyloxy)-3-piperidino-2-propanol is a chemical compound with a unique structure that consists of a piperidine ring, a propanol group, and an indanyloxy group. It is commonly used as a beta-adrenergic agonist, which means it can stimulate beta receptors in the body. This can lead to various physiological effects, including increased heart rate, bronchodilation, and relaxation of smooth muscles. As a result, it is often used in the treatment of conditions such as asthma, bronchitis, and other respiratory disorders. Additionally, it may also have potential applications in the field of neuroscience and neuropharmacology due to its interactions with certain neurotransmitter systems.
Check Digit Verification of cas no
The CAS Registry Mumber 67465-91-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,4,6 and 5 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 67465-91:
(7*6)+(6*7)+(5*4)+(4*6)+(3*5)+(2*9)+(1*1)=162
162 % 10 = 2
So 67465-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H25NO2/c19-15(12-18-10-2-1-3-11-18)13-20-17-9-5-7-14-6-4-8-16(14)17/h5,7,9,15,19H,1-4,6,8,10-13H2