675602-91-2 Usage
Uses
Used in Pharmaceutical Industry:
2,3,5-Trifluoropyridine-4-carboxylic acid, 97% is used as a key intermediate in the synthesis of various drugs. Its unique structure and properties make it a valuable component in the development of new pharmaceuticals with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical sector, 2,3,5-Trifluoropyridine-4-carboxylic acid, 97% is utilized as a building block for the creation of novel agrochemicals. Its incorporation into these compounds can enhance their performance, leading to more effective pest control and crop protection.
Used in Fine Chemicals Industry:
2,3,5-Trifluoropyridine-4-carboxylic acid, 97% also finds application in the synthesis of fine chemicals, which are high-purity chemicals used in various industries such as fragrances, flavors, and specialty materials. Its presence in these compounds can contribute to their unique properties and performance.
Check Digit Verification of cas no
The CAS Registry Mumber 675602-91-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,5,6,0 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 675602-91:
(8*6)+(7*7)+(6*5)+(5*6)+(4*0)+(3*2)+(2*9)+(1*1)=182
182 % 10 = 2
So 675602-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H2F3NO2/c7-2-1-10-5(9)4(8)3(2)6(11)12/h1H,(H,11,12)
