675602-92-3 Usage
Uses
Used in Chemical Industry:
2,3,6-Trifluoroisonicotinic acid is used as a building block for the synthesis of various chemical compounds. Its unique structure and fluorine atoms contribute to the development of new materials with improved properties.
Used in Pharmaceutical Industry:
2,3,6-Trifluoroisonicotinic acid is used as a key intermediate in the development of pharmaceutical compounds. Its presence in the molecular structure can enhance the bioavailability and stability of drugs, making it a valuable component in the creation of new medications.
Used in Research and Development:
2,3,6-Trifluoroisonicotinic acid is employed as a research tool in the study of chemical and pharmaceutical properties. Its unique characteristics allow scientists to explore new avenues in drug discovery and the development of novel compounds with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 675602-92-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,5,6,0 and 2 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 675602-92:
(8*6)+(7*7)+(6*5)+(5*6)+(4*0)+(3*2)+(2*9)+(1*2)=183
183 % 10 = 3
So 675602-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H2F3NO2/c7-3-1-2(6(11)12)4(8)5(9)10-3/h1H,(H,11,12)
