67589-38-2 Usage
Uses
Used in Pharmaceutical Industry:
(4-methoxyphenyl) 4-propylcyclohexane-1-carboxylate is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure, including the methoxyphenyl and propyl groups, may contribute to the development of new drugs with specific therapeutic properties.
Used in Agricultural Products:
In the agricultural sector, (4-methoxyphenyl) 4-propylcyclohexane-1-carboxylate may be utilized as a component in the formulation of agrochemicals, such as pesticides or herbicides. Its chemical properties could potentially enhance the effectiveness of these products in managing pests and weeds.
Used in Organic Synthesis:
As a chemical intermediate, (4-methoxyphenyl) 4-propylcyclohexane-1-carboxylate plays a crucial role in organic synthesis, enabling the creation of a wide range of organic compounds. Its versatility in reacting with other chemicals makes it a valuable component in the synthesis of various organic molecules for different applications.
Check Digit Verification of cas no
The CAS Registry Mumber 67589-38-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,5,8 and 9 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 67589-38:
(7*6)+(6*7)+(5*5)+(4*8)+(3*9)+(2*3)+(1*8)=182
182 % 10 = 2
So 67589-38-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H24O3/c1-3-4-13-5-7-14(8-6-13)17(18)20-16-11-9-15(19-2)10-12-16/h9-14H,3-8H2,1-2H3
