67634-20-2 Usage
General Description
3A,4,5,6,7,7A-HEXAHYDRO-4,7-METHANO-1(3)H-INDEN-6-YL ISOBUTYRATE is a chemical compound that belongs to the class of esters. It is derived from the reaction of isobutyric acid and a hexahydro-4,7-methano-1(3)H-inden-6-ol. 3A,4,5,6,7,7A-HEXAHYDRO-4,7-METHANO-1(3)H-INDEN-6-YL ISOBUTYRATE has a complex chemical structure and is commonly used as a fragrance ingredient in various consumer products such as personal care items, perfumes, and air fresheners. It is known for its sweet, floral, and woody odor and is often used to add a pleasant scent to products. Additionally, it is a versatile chemical with potential applications in the pharmaceutical and agrochemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 67634-20-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,6,3 and 4 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 67634-20:
(7*6)+(6*7)+(5*6)+(4*3)+(3*4)+(2*2)+(1*0)=142
142 % 10 = 2
So 67634-20-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H20O2/c1-8(2)14(15)16-13-7-9-6-12(13)11-5-3-4-10(9)11/h3,5,8-13H,4,6-7H2,1-2H3
