67701-00-2 Usage
Uses
Used in Chemical Synthesis:
Amines, tri-C14-18-alkyl, are used as intermediates in the synthesis of various chemicals, such as surfactants, corrosion inhibitors, and fabric softeners. They play a crucial role in the production of these chemicals, contributing to their effectiveness and performance.
Used in Industrial Processes:
Amines, tri-C14-18-alkyl, are used as neutralizers or pH adjusters in industrial processes. Their ability to regulate pH levels helps maintain optimal conditions for various chemical reactions and processes, ensuring the desired outcomes and product quality.
Used in Chemical Reactions:
Amines, tri-C14-18-alkyl, are used in chemical reactions to form salts, esters, and other derivatives. Their reactivity with other compounds allows for the creation of a wide range of products, expanding the potential applications of these amines in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 67701-00-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,7,0 and 1 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 67701-00:
(7*6)+(6*7)+(5*7)+(4*0)+(3*1)+(2*0)+(1*0)=122
122 % 10 = 2
So 67701-00-2 is a valid CAS Registry Number.
InChI:InChI=1/C46H95N/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-47(44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h4-46H2,1-3H3