677012-43-0 Usage
General Description
AKOS B004827 refers to a chemical compound that is identified by its unique identifier. Its specific properties and uses are not mentioned in the identifier itself, but it likely represents a specific chemical compound or formulation with potential applications in various industries. Further information about AKOS B004827 would be required to provide a more detailed summary of its chemical structure, properties, and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 677012-43-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,7,0,1 and 2 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 677012-43:
(8*6)+(7*7)+(6*7)+(5*0)+(4*1)+(3*2)+(2*4)+(1*3)=160
160 % 10 = 0
So 677012-43-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BrO5/c1-15-8-3-6(4-12)2-7(11)10(8)16-5-9(13)14/h2-4H,5H2,1H3,(H,13,14)