677297-87-9 Usage
Uses
Used in Pharmaceutical Industry:
1,2,4-Benzotriazin-3-amine, 7-bromo-5-methyl-, 1-oxide is used as a building block for the synthesis of various biologically active compounds. Its unique structural characteristics and reactivity make it a promising candidate for the development of new drugs and pharmaceutical agents.
Used in Agrochemical Industry:
1,2,4-Benzotriazin-3-amine, 7-bromo-5-methyl-, 1-oxide is also used in the agrochemical industry for the development of new pesticides and other agrochemical products. Its versatile reactivity allows for the creation of compounds with specific properties and functions, making it a valuable component in the design and synthesis of novel agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 677297-87-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,7,7,2,9 and 7 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 677297-87:
(8*6)+(7*7)+(6*7)+(5*2)+(4*9)+(3*7)+(2*8)+(1*7)=229
229 % 10 = 9
So 677297-87-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BrN4O/c1-4-2-5(9)3-6-7(4)11-8(10)12-13(6)14/h2-3H,1H3,(H2,10,11,12)
