67810-56-4 Usage
General Description
The chemical "GLY-GLY-PHE-MET-THR-SER-GLU-LYS-SER-GLN-THR-PRO-LEU-VAL-THR-LEU" is a peptide composed of 16 amino acids linked together in a specific sequence. The peptide contains the amino acids glycine (GLY), phenylalanine (PHE), methionine (MET), threonine (THR), serine (SER), glutamic acid (GLU), lysine (LYS), glutamine (GLN), proline (PRO), leucine (LEU), and valine (VAL). It is a complex molecule with potential biological significance, as peptides are often involved in various biological processes and can have therapeutic applications. The specific sequence of amino acids in this peptide may determine its function and interactions with other molecules in biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 67810-56-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,8,1 and 0 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 67810-56:
(7*6)+(6*7)+(5*8)+(4*1)+(3*0)+(2*5)+(1*6)=144
144 % 10 = 4
So 67810-56-4 is a valid CAS Registry Number.
InChI:InChI=1/C74H122N18O25S/c1-36(2)29-47(66(108)88-57(38(5)6)70(112)90-59(40(8)96)71(113)85-49(74(116)117)30-37(3)4)84-69(111)52-20-16-27-92(52)73(115)60(41(9)97)91-63(105)44(21-23-53(77)98)81-67(109)50(34-93)86-61(103)43(19-14-15-26-75)80-62(104)45(22-24-56(101)102)82-68(110)51(35-94)87-72(114)58(39(7)95)89-64(106)46(25-28-118-10)83-65(107)48(31-42-17-12-11-13-18-42)79-55(100)33-78-54(99)32-76/h11-13,17-18,36-41,43-52,57-60,93-97H,14-16,19-35,75-76H2,1-10H3,(H2,77,98)(H,78,99)(H,79,100)(H,80,104)(H,81,109)(H,82,110)(H,83,107)(H,84,111)(H,85,113)(H,86,103)(H,87,114)(H,88,108)(H,89,106)(H,90,112)(H,91,105)(H,101,102)(H,116,117)/t39-,40-,41-,43+,44+,45+,46+,47+,48+,49+,50+,51+,52+,57+,58+,59+,60+/m1/s1