67828-58-4 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-Methyl-4-nitrophenyl)pyrrolidine is utilized as an intermediate in the synthesis of various drugs and active pharmaceutical ingredients. Its distinctive chemical structure allows for the development of new medications with diverse therapeutic applications, contributing to the advancement of pharmaceutical research and drug discovery.
Used in Research and Development:
In the field of organic synthesis and drug development, 1-(2-Methyl-4-nitrophenyl)pyrrolidine serves as a valuable research chemical. Its properties and reactivity are studied to understand and optimize the synthesis processes of potential new drugs, thereby playing a crucial role in the innovation of pharmaceutical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 67828-58-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,8,2 and 8 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 67828-58:
(7*6)+(6*7)+(5*8)+(4*2)+(3*8)+(2*5)+(1*8)=174
174 % 10 = 4
So 67828-58-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O2/c1-9-8-10(13(14)15)4-5-11(9)12-6-2-3-7-12/h4-5,8H,2-3,6-7H2,1H3
