67910-07-0 Usage
Uses
Used in Pharmaceutical Industry:
Homobaldrinal is used as a key intermediate for the synthesis of pharmaceuticals, contributing to the development of new drugs and enhancing the production of existing ones. Its role in this industry is pivotal due to its ability to facilitate the creation of complex chemical compounds that are essential for medicinal applications.
Used in Organic Chemistry:
As a chiral building block, homobaldrinal is utilized in the synthesis of chiral alcohols and other organic molecules. Its unique properties allow for the creation of enantiomerically pure compounds, which are crucial in various chemical reactions and applications where stereochemistry plays a significant role.
Used in Chemical Industry:
Homobaldrinal's wide-ranging applications extend to the chemical industry, where it is employed as a building block for the production of a variety of complex chemical compounds. Its versatility and reactivity make it a valuable tool in the synthesis of specialty chemicals and materials with specific properties tailored for various industrial uses.
Check Digit Verification of cas no
The CAS Registry Mumber 67910-07-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,9,1 and 0 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 67910-07:
(7*6)+(6*7)+(5*9)+(4*1)+(3*0)+(2*0)+(1*7)=140
140 % 10 = 0
So 67910-07-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H16O4/c1-10(2)5-15(17)19-8-12-7-18-9-14-11(6-16)3-4-13(12)14/h3-4,6-7,9-10H,5,8H2,1-2H3
