67939-26-8 Usage
Uses
Used in Polymer Synthesis:
[2-(methacryloyloxy)ethyl]dimethylammonium hydrogen sulphate is used as a monomer in the synthesis of various polymers and copolymers. Its cationic nature and reactive functional groups facilitate the formation of polymers with tailored properties for specific applications.
Used in Surface-Active Agents and Surfactants:
In the chemical industry, [2-(methacryloyloxy)ethyl]dimethylammonium hydrogen sulphate is used as a reactant in the preparation of surface-active agents and surfactants. Its cationic properties contribute to the effectiveness of these products in reducing surface tension and stabilizing emulsions.
Used in Biomedical Applications:
In the biomedical field, [2-(methacryloyloxy)ethyl]dimethylammonium hydrogen sulphate is utilized in the development of drug delivery systems and medical adhesives. Its cationic nature allows for enhanced interaction with biological tissues and targeted drug delivery.
Used in Water Treatment Processes:
As an antistatic agent and coagulant, [2-(methacryloyloxy)ethyl]dimethylammonium hydrogen sulphate is employed in water treatment processes. Its positively charged nitrogen atoms help in the removal of suspended particles and impurities from water, improving water quality.
Used as a Catalyst or Stabilizer:
In various chemical reactions and processes, [2-(methacryloyloxy)ethyl]dimethylammonium hydrogen sulphate can be used as a catalyst or a stabilizer. Its cationic properties enable it to facilitate and control the rate of chemical reactions, leading to more efficient and controlled processes.
Check Digit Verification of cas no
The CAS Registry Mumber 67939-26-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,9,3 and 9 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 67939-26:
(7*6)+(6*7)+(5*9)+(4*3)+(3*9)+(2*2)+(1*6)=178
178 % 10 = 8
So 67939-26-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H14NO2.H2O4S/c1-7(2)8(10)11-6-5-9(3)4;1-5(2,3)4/h5H,1,6H2,2-4H3;(H2,1,2,3,4)/q+1;/p-1
