67939-54-2 Usage
Uses
Used in Chemical Synthesis Industry:
1-BROMO-1-CHLORO-1-PROPENE is used as a chemical intermediate for the production of various organic compounds, including pesticides and pharmaceuticals. Its high reactivity allows it to be a key component in the synthesis of a wide range of products, contributing to the versatility and efficiency of chemical manufacturing processes.
Used in Pesticide Production:
1-BROMO-1-CHLORO-1-PROPENE is utilized as a starting material in the creation of pesticides. Its reactivity enables the development of effective compounds designed to control, repel, or kill pests, thereby playing a crucial role in agricultural and horticultural applications to protect crops and maintain yields.
Used in Pharmaceutical Manufacturing:
In the pharmaceutical industry, 1-BROMO-1-CHLORO-1-PROPENE serves as a building block for the synthesis of various medicinal compounds. Its ability to undergo different types of chemical reactions makes it a valuable asset in the development of new drugs and the improvement of existing ones, enhancing the range of treatments available for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 67939-54-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,9,3 and 9 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 67939-54:
(7*6)+(6*7)+(5*9)+(4*3)+(3*9)+(2*5)+(1*4)=182
182 % 10 = 2
So 67939-54-2 is a valid CAS Registry Number.
InChI:InChI=1/C3H4BrCl/c1-2-3(4)5/h2H,1H3/b3-2-
