68015-95-2 Usage
Uses
Used in Organic Synthesis:
2-(chloromethyl)-1-(1-methylpropyl)-4-nitrobenzene is used as a building block in organic synthesis for the preparation of a range of compounds, including pharmaceuticals, agrochemicals, and dyes. Its unique structure allows for versatile chemical reactions, making it a valuable intermediate in the synthesis of complex organic molecules.
Used in Chemical Research:
In the field of chemical research, 2-(chloromethyl)-1-(1-methylpropyl)-4-nitrobenzene serves as a model compound for studying the reactivity and properties of nitrobenzene derivatives. Researchers use 2-(chloromethyl)-1-(1-methylpropyl)-4-nitrobenzene to explore new synthetic pathways and to understand the effects of substituents on the benzene ring.
Used in Pharmaceutical Industry:
2-(chloromethyl)-1-(1-methylpropyl)-4-nitrobenzene is used as a key intermediate in the synthesis of certain pharmaceuticals. Its presence in the molecular structure can impart specific biological activities, making it a crucial component in the development of new drugs.
Used in Agrochemical Industry:
2-(chloromethyl)-1-(1-methylpropyl)-4-nitrobenzene also finds application in the agrochemical industry, where it is used in the synthesis of various agrochemicals. Its ability to be modified and incorporated into different chemical structures allows for the creation of effective pesticides and other agricultural chemicals.
Used in Dye Industry:
2-(chloromethyl)-1-(1-methylpropyl)-4-nitrobenzene is utilized in the dye industry for the production of dyes with specific color properties. Its chemical structure contributes to the color characteristics of the dyes, making it an important component in the formulation of various dye products.
Check Digit Verification of cas no
The CAS Registry Mumber 68015-95-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,0,1 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 68015-95:
(7*6)+(6*8)+(5*0)+(4*1)+(3*5)+(2*9)+(1*5)=132
132 % 10 = 2
So 68015-95-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H14ClNO2/c1-3-8(2)11-5-4-10(13(14)15)6-9(11)7-12/h4-6,8H,3,7H2,1-2H3
