680214-71-5 Usage
Uses
Used in Medicinal Chemistry:
6-(CHLOROMETHYL)-2-(3-METHYLPHENYL)PYRIMIDIN-4-OL is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structural features make it a candidate for further investigation in drug development.
Used in Drug Development:
In the pharmaceutical industry, 6-(CHLOROMETHYL)-2-(3-METHYLPHENYL)PYRIMIDIN-4-OL is used as a potential drug candidate. Its properties and reactivity are being explored for the development of new medications or treatments that could address unmet medical needs.
Used in Organic Chemistry Research:
6-(CHLOROMETHYL)-2-(3-METHYLPHENYL)PYRIMIDIN-4-OL serves as a valuable tool for researchers in the field of organic chemistry. Its unique structure and reactivity allow for the exploration of new chemical reactions and the synthesis of novel compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 680214-71-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,8,0,2,1 and 4 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 680214-71:
(8*6)+(7*8)+(6*0)+(5*2)+(4*1)+(3*4)+(2*7)+(1*1)=145
145 % 10 = 5
So 680214-71-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H11ClN2O/c1-8-3-2-4-9(5-8)12-14-10(7-13)6-11(16)15-12/h2-6H,7H2,1H3,(H,14,15,16)
