680601-90-5 Usage
Pyridazine derivative
A derivative of pyridazine This means that the compound is structurally related to pyridazine, a five-membered heterocyclic compound with two nitrogen atoms, and has undergone chemical modifications.
Carboxylic acid group
Contains a -COOH functional group This indicates the presence of a carboxyl group in the compound, which is a common functional group in organic acids and is responsible for their acidic properties.
Potential applications in pharmaceuticals
May be used in drug development This suggests that the compound could be used as a building block or intermediate in the synthesis of pharmaceutical compounds, potentially leading to new medications.
Organic synthesis
Can be used as a building block for synthesizing other molecules This means that the compound can be chemically modified or combined with other compounds to create new organic molecules with various properties and applications.
Biologically active molecules
May be used to synthesize molecules with biological activity This implies that the compound could be used to create molecules that interact with biological systems, potentially leading to new therapeutic agents or other applications.
Medicinal properties
Structure suggests potential for medicinal use The compound's structure indicates that it may have properties that could be beneficial in a medicinal context, although further research is needed to confirm this.
Further research and testing required
Properties and potential uses not yet fully understood This highlights the need for additional studies and experiments to better understand the compound's properties, applications, and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 680601-90-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,8,0,6,0 and 1 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 680601-90:
(8*6)+(7*8)+(6*0)+(5*6)+(4*0)+(3*1)+(2*9)+(1*0)=155
155 % 10 = 5
So 680601-90-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H14N2O2/c15-12(16)11-7-4-8-13-14(11)9-10-5-2-1-3-6-10/h1-3,5-6,8,11H,4,7,9H2,(H,15,16)/t11-/m0/s1
