6807-92-7 Usage
Uses
Used in Pharmaceutical Industry:
(R)-3-AMINO-PYRROLIDINE-3-CARBOXYLIC ACID serves as a crucial precursor in the synthesis of various pharmaceuticals. Its specific interaction with biological systems allows for the development of targeted and effective medications.
Used in Organic Compound Synthesis:
In the field of organic chemistry, (R)-3-AMINO-PYRROLIDINE-3-CARBOXYLIC ACID acts as a building block for the creation of diverse chemical compounds, contributing to advancements in material science and chemical research.
Used in Medical Research:
The (R)-enantiomer of 3-amino-pyrrolidine-3-carboxylic acid is frequently employed in medical research for its ability to engage with biological systems in a highly specific manner, facilitating the discovery and development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 6807-92-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,8,0 and 7 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6807-92:
(6*6)+(5*8)+(4*0)+(3*7)+(2*9)+(1*2)=117
117 % 10 = 7
So 6807-92-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O2/c6-5(4(8)9)1-2-7-3-5/h7H,1-3,6H2,(H,8,9)/t5-/m1/s1
