68074-63-5 Usage
Uses
Used in Pharmaceutical Industry:
1H-IMIDAZO[4,5-C]PYRIDIN-2-AMINE is used as a key intermediate in the synthesis of various biologically active molecules for pharmaceutical applications. Its unique structure allows for the creation of diverse compounds with potential therapeutic effects.
Used in Antitumor Research:
Some derivatives of 1H-IMIDAZO[4,5-C]PYRIDIN-2-AMINE have been studied for their potential antitumor properties. They are used as research compounds to explore their effects on tumor cells and their possible use in the development of anticancer drugs.
Used in Antimicrobial Research:
1H-IMIDAZO[4,5-C]PYRIDIN-2-AMINE and its derivatives are also being investigated for their potential antimicrobial properties. They are used as research compounds to understand their effects on various microorganisms and their potential use in the development of new antimicrobial agents.
Check Digit Verification of cas no
The CAS Registry Mumber 68074-63-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,0,7 and 4 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 68074-63:
(7*6)+(6*8)+(5*0)+(4*7)+(3*4)+(2*6)+(1*3)=145
145 % 10 = 5
So 68074-63-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c7-6-9-4-1-2-8-3-5(4)10-6/h1-3H,(H3,7,9,10)
