68084-04-8 Usage
Description
3-(4-Methyl-3-pentenyl)cyclohex-3-ene-1-carbonitrile is a cycloalkene chemical compound characterized by the presence of a nitrile group and a pentenyl substituent. This unique structure, featuring a five-carbon chain with a double bond and a methyl group, positions it as a valuable compound in organic synthesis and pharmaceutical research.
Uses
Used in Organic Synthesis:
3-(4-Methyl-3-pentenyl)cyclohex-3-ene-1-carbonitrile is used as a key intermediate in organic synthesis for the creation of various chemical compounds. Its distinctive structure allows for versatile reactions and the formation of a wide range of products.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 3-(4-Methyl-3-pentenyl)cyclohex-3-ene-1-carbonitrile is utilized as a building block for the development of new drugs. Its unique molecular architecture contributes to the design of innovative pharmaceuticals with potential therapeutic applications.
Used in Material Science:
3-(4-Methyl-3-pentenyl)cyclohex-3-ene-1-carbonitrile also finds applications in material science, where its properties can be harnessed to develop new materials with specific characteristics, such as improved stability or reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 68084-04-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,0,8 and 4 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 68084-04:
(7*6)+(6*8)+(5*0)+(4*8)+(3*4)+(2*0)+(1*4)=138
138 % 10 = 8
So 68084-04-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H19N/c1-11(2)5-3-6-12-7-4-8-13(9-12)10-14/h5,7,13H,3-4,6,8-9H2,1-2H3
