68087-13-8 Usage
Uses
Used in Pharmaceutical Industry:
4-Hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine is used as a key intermediate in the synthesis of various drugs and pharmaceutical products. Its unique structure and functional groups make it a valuable building block for the development of new therapeutic agents.
Used in Drug Synthesis:
4-Hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine is utilized as a starting material for the creation of novel drug molecules. Its presence in the molecular structure can impart specific biological activities, making it a crucial component in the design and synthesis of new pharmaceuticals.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 4-Hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine serves as a valuable research tool. Scientists can use 4-HYDROXY-6-METHOXYMETHYL-2-(METHYLTHIO)PYRIMIDINE to study the structure-activity relationships of pyrimidine-based drugs, leading to the discovery of more effective and safer therapeutic agents.
Used in Agriculture (if applicable):
While the primary use of 4-Hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine is in the pharmaceutical industry, it may also have potential applications in agriculture. Its specific use in this industry would depend on further research and development, as well as regulatory approvals.
Used in Chemical Manufacturing (if applicable):
In the chemical manufacturing industry, 4-Hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine could be employed as a raw material or intermediate in the production of various chemical products. Its versatility and unique functional groups may contribute to the development of new chemical processes and products.
Check Digit Verification of cas no
The CAS Registry Mumber 68087-13-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,0,8 and 7 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 68087-13:
(7*6)+(6*8)+(5*0)+(4*8)+(3*7)+(2*1)+(1*3)=148
148 % 10 = 8
So 68087-13-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O2S/c1-11-4-5-3-6(10)9-7(8-5)12-2/h3H,4H2,1-2H3,(H,8,9,10)
