68104-62-1 Usage
Uses
Used in Pharmaceutical Industry:
1-(4-Bromophenyl)piperazine hydrochloride is used as a synthetic intermediate for the development of large bifunctional heterocycles. These heterocycles are essential in the targeted degradation of rapidly accelerated fibrosarcoma (RAF) polypeptides, which play a crucial role in the progression of certain types of cancer. By targeting and degrading these polypeptides, 1-(4-Bromophenyl)piperazine hydrochloride can potentially contribute to the development of novel anticancer therapies.
Used in Chemical Research:
1-(4-Bromophenyl)piperazine hydrochloride is also utilized as a research compound in the field of organic chemistry. Its unique structure allows chemists to explore various synthetic routes and reactions, leading to the development of new compounds with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 68104-62-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,0 and 4 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 68104-62:
(7*6)+(6*8)+(5*1)+(4*0)+(3*4)+(2*6)+(1*2)=121
121 % 10 = 1
So 68104-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H13BrN2.ClH/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13;/h1-4,12H,5-8H2;1H
